← All notes

Elemetry Analysis

My understanding of the Real Analysis

Set of Natural Number

There is a set of 5 axioms called Peano Axioms. First 4 of them are obvious and 5th one is a bit confusing. But the 5th axiom lets us use the method of Induction for doing proofs.

A subset of N\mathbb{N} which contains 11, and contains n+1n+1, whenever contains nn will be equal to N\mathbb{N}.

This is analogous to the key philosophy we use for proof by induction.

Set of Rational Numbers

First we extent the N\mathbb{N} to have Z\mathbb{Z}, then a number is a rational number if it can be represented as ratio of two integers, i.e.,

ab,a,bZ,b0\frac{a}{b}, \quad a, b \in \mathbb{Z}, \quad b\neq0

The evolution of number system goes like

  1. Start counting, we get N\mathbb{N} with addition.
  2. Then add subtraction to it, we get Z\mathbb{Z}.
  3. Now add division, we get Q\mathbb{Q}.

But there are still holes in the Q\mathbb{Q}. Think of a graph of function x22=0x^{2} - 2 = 0, where roots are x=±2x = \pm\sqrt{ 2 }. But 2\sqrt{2 } is not a rational number. In the graph below there’s a hole on xx axis, where xx axis is denoting all rational number. Pasted image 20260204185818.png

Rational Zero Theorem

#theorem Suppose c0,c1,c2cnc_{0}, c_{1}, c_{2}\dots c_{n} are integers and rr is a rational number satisfying the polynomial below, n>0n>0 and c00,cn0c_{0} \neq 0, c_{n}\neq0. And r=abr = \frac{a}{b}, where a,bZa, b \in \mathbb{Z} and b0b \neq 0, then aa divides c0c_{0} and bb divides cnc_{n}.

cnxn+cn1xn1++c1x+c0=0(1)c_{n}x^{n} + c_{n-1}x^{n-1} + \dots + c_{1}x + c_{0} = 0 \tag 1

Only rational solution for (1)(1) of form ab\frac{a}{b} are solutions where aa divides c0c_{0} and bb divides cnc_{n}.

Interestingly, with the Rational Zero Theorem, one can prove claims such as ”2\sqrt{ 2 } is not a rational number”

For proof, take the polynomial x22=0x^{2} - 2 = 0, comparing it to (1)(1), we have c2=1,c0=2c_{2} = 1, c_{0} = -2. So only possible rational solution candidates are ±1,±2\pm1, \pm2. One can verify that none of them are solution, so there are no rational solution for this polynomial. This the actual solution 2\sqrt{ 2 } is not a rational number.

Set of Real Numbers

Intuitively we talk about R\mathbb{R} as a set with gaps filled of Q\mathbb{Q}. But actual Development of R\mathbb{R} from Q\mathbb{Q} is a book to study in itself. For analysis we are directly working with the pretext that R\mathbb{R} as an algebraic system.

Field

A field is a set which satisfies the following properties:

  1. a+(b+c)=(a+b)+c,for all a,b,ca + (b + c) = (a + b) + c, \quad \text{for all } a, b, c - Associative law
  2. a+b=b+a,for all a,ba + b = b + a, \quad \text{for all } a, b: Commutative law
  3. a+0=a,for all aa + 0 = a, \text{for all } a: Identity element
  4. For each aa there’s an element a-a such that, a+(a)=0a + (-a) = 0: Inverse
  5. a(bc)=(ab)c,for all a,b,ca(bc) = (ab)c, \text{for all } a, b, c: Associative law
  6. ab=ba,for all a,bab = ba, \quad \text{for all }a, b: Commutative law
  7. a1=a,for all aa \cdot 1 = a, \quad \text{for all } a: Identity element
  8. For each a0a\neq 0, there exists a1a^{-1} such that, aa1=1a \cdot a^{-1} = 1: Inverse
  9. a(b+c)=ab+aca (b + c) = ab + ac for all a,b,ca, b, c: Distributive law

A set with more than one element which follows all 9 properties above is called as a Field. Q\mathbb{Q} is a field, and R\mathbb{R} is too.

Ordered Field

If there exists an ordering structure, then

  1. Either aba \leq b or bab \leq a
  2. If aba \leq b and bcb \leq c then aca \leq c. (Transitivity)
  3. If aba \leq b and bab \leq a, then a=ba = b.
  4. If aba \leq b then, a+cb+ca + c \leq b + c.
  5. If aba \leq b and c0c \geq 0 then acbcac \leq bc.

If any field satisfy these 5 properties then it’s called as an Ordered Field. Q\mathbb{Q} and R\mathbb{R} are both ordered fields. Most of the arithmetic we do are based off this ordered field properties. For real analysis, all the required properties can be derived/proved with help of above. For Real Analysis, we need:

Real numbers, i.e., elements of R\mathbb{R}, can be added together and multiplied together. That is, given real numbers aa and bb, the sum a+ba+b and the product abab also represent real numbers. Moreover, these operations satisfy the field properties 1 through 4 (addition), 5 through 8 (multiplication), and 9 (distributive law). The set R\mathbb{R} also has an order structure \leq that satisfies properties of ordered filed, 1 through 5. Thus, like Q,R\mathbb{Q}, \mathbb{R} is an ordered field.

Now interestingly, all the properties which I used to take as obvious assumptions are in fact implications of the field properties. It just R\mathbb{R} is such an ubiquitously used that we take the following as implicit building blocks. That mean, if we take any non-empty set satisfying ordered field properties, we can have these same operations be done one them.

Screenshot 2026-02-05 at 2.29.42 PM Pasted image 20260205143056

All the above properties can be proved just by using field and ordered field properties.

Distance

For numbers aa and bb, we define distance as dist(a,b)=ab\text{dist}(a, b) = |a - b|; where |\cdot| is absolute value given as:

a=aa0,anda=aa<0|a| = a \quad\forall a \geq 0, \quad \text{and} \quad|a| = -a \quad \forall a<0

Theorem 3.5

  1. a0|a| \geq 0 for all aRa \in \mathbb{R}
  2. ab=ab|a\cdot b| = |a|\cdot|b| for all a,bRa, b \in \mathbb{R}
  3. a+ba+b|a + b| \leq |a| + |b| for all a,bRa, b \in \mathbb{R}

Corollary 3.6: Triangle Inequality

dist(a,b)dist(a,c)+dist(c,d)\text{dist}(a, b) \leq \text{dist}(a, c) + \text{dist}(c, d) for all a,b,cRa, b, c \in \mathbb{R}.

This is generally even known as Triangle Inequality.

Completeness Axiom

Written by Rudresh Veerkhare.